Products 61964-00-9
CAS 61964-00-9 appears in our catalog under these names: N2-(6-Methylpyridin-2-yl)pyridine-2,3-diamine, 96%, N2-(6-Methylpyridin-2-yl)pyridine-2,3-diamine, 96%, 96%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2-N-(6-methyl-2-pyridinyl)pyridine-2,3-diamine (CAS 61964-00-9) is a chemical compound with the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. IUPAC name: 2-N-(6-methyl-2-pyridinyl)pyridine-2,3-diamine. InChIKey: OGHCTAXPJRLHPP-UHFFFAOYSA-N.
| Molecular formula | C11H12N4 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 2-N-(6-methyl-2-pyridinyl)pyridine-2,3-diamine |
| InChIKey | OGHCTAXPJRLHPP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC2=C(C=CC=N2)N |
Computed by PubChem (NCBI)