CAS 620-50-8 is the registry number for N,N'-(Di-m-methylphenyl)urea. Offered by: Biosynth. Available pack sizes: 10g.
1,3-bis(3-methylphenyl)urea (CAS 620-50-8) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 1,3-bis(3-methylphenyl)urea. InChIKey: UPUMJVLEADOLKF-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,3-bis(3-methylphenyl)urea |
| InChIKey | UPUMJVLEADOLKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)