Products 62018-49-9
CAS 62018-49-9 is the registry number for 2-tert-Butyl-2-methyl-1,3-dioxane-4,6-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-tert-butyl-2-methyl-1,3-dioxane-4,6-dione (CAS 62018-49-9) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 2-tert-butyl-2-methyl-1,3-dioxane-4,6-dione. InChIKey: COOZARBOMFFIFW-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-tert-butyl-2-methyl-1,3-dioxane-4,6-dione |
| InChIKey | COOZARBOMFFIFW-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)CC(=O)O1)C(C)(C)C |
Computed by PubChem (NCBI)