Products 62072-62-2

CAS 62072-62-2 is the registry number for Cetilistat Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloroethyl N-(3-hydroxy-4-methylphenyl)carbamate (CAS 62072-62-2) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 2-chloroethyl N-(3-hydroxy-4-methylphenyl)carbamate. InChIKey: FVEIXLNETMGWLK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO3
Molecular weight229.66 g/mol
IUPAC name2-chloroethyl N-(3-hydroxy-4-methylphenyl)carbamate
InChIKeyFVEIXLNETMGWLK-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NC(=O)OCCCl)O

Computed by PubChem (NCBI)