CAS 6223-31-0 is the registry number for 2–Hydroxy–6–methoxynaphthalene–1,4–dione. Offered by: GLPBio. Available pack sizes: 100mg.
4-hydroxy-6-methoxynaphthalene-1,2-dione (CAS 6223-31-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 4-hydroxy-6-methoxynaphthalene-1,2-dione. InChIKey: NHDJZQSOUDOKRS-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 4-hydroxy-6-methoxynaphthalene-1,2-dione |
| InChIKey | NHDJZQSOUDOKRS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(=O)C=C2O |
Computed by PubChem (NCBI)