CAS 62234-28-0 is the registry number for (R)-3-Amino-2-(4-methylphenylsulfonamido)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-amino-2-[(4-methylphenyl)sulfonylamino]propanoic acid (CAS 62234-28-0) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: (2R)-3-amino-2-[(4-methylphenyl)sulfonylamino]propanoic acid. InChIKey: NOFBBVASBDIESZ-SECBINFHSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | (2R)-3-amino-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
| InChIKey | NOFBBVASBDIESZ-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)