CAS 623147-03-5 is the registry number for 2-methoxyquinolin-6-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-methoxyquinolin-6-ol (CAS 623147-03-5) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-methoxyquinolin-6-ol. InChIKey: HNLXDDVEGXVWFW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-methoxyquinolin-6-ol |
| InChIKey | HNLXDDVEGXVWFW-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)