Products 62356-47-2
CAS 62356-47-2 is the registry number for Isotschimgin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-hydroxybenzoate (CAS 62356-47-2) is a chemical compound with the molecular formula C17H22O3 and a molecular weight of 274.35 g/mol. IUPAC name: [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-hydroxybenzoate. InChIKey: WZBMPPVYPMMRNT-RVSPLBMKSA-N.
| Molecular formula | C17H22O3 |
|---|---|
| Molecular weight | 274.35 g/mol |
| IUPAC name | [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-hydroxybenzoate |
| InChIKey | WZBMPPVYPMMRNT-RVSPLBMKSA-N |
| SMILES | C[C@]12CC[C@H](C1(C)C)C[C@@H]2OC(=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)