CAS 623581-89-5 appears in our catalog under these names: 6-Phenyl-1,2-thiazinane 1,1-dioxide, 98%, Tetrahydro-​6-​phenyl-​2H-​1,​2-thiazine 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
6-phenylthiazinane 1,1-dioxide (CAS 623581-89-5) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 6-phenylthiazinane 1,1-dioxide. InChIKey: SHQXWTHWFCXYLR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 6-phenylthiazinane 1,1-dioxide |
| InChIKey | SHQXWTHWFCXYLR-UHFFFAOYSA-N |
| SMILES | C1CC(S(=O)(=O)NC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)