CAS 6238-96-6 is the registry number for 6-(tert-Butyl)-2h-1,4-benzoxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-tert-butyl-4H-1,4-benzoxazin-3-one (CAS 6238-96-6) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 6-tert-butyl-4H-1,4-benzoxazin-3-one. InChIKey: RBEMVEIJGYOVMA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 6-tert-butyl-4H-1,4-benzoxazin-3-one |
| InChIKey | RBEMVEIJGYOVMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OCC(=O)N2 |
Computed by PubChem (NCBI)