CAS 62470-46-6 is the registry number for p-Vinylphenyl O-beta-D-glucopyranoside. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2S,3R,4S,5S,6R)-2-(4-ethenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 62470-46-6) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(4-ethenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: UBOROQNWLSDLJF-RKQHYHRCSA-N.
| Molecular formula | C14H18O6 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(4-ethenylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | UBOROQNWLSDLJF-RKQHYHRCSA-N |
| SMILES | C=CC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)