CAS 62529-01-5 appears in our catalog under these names: Nafamostat Impurity 10, Nafamostat Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxynaphthalene-2-carboxamide (CAS 62529-01-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 6-hydroxynaphthalene-2-carboxamide. InChIKey: AHOQHQUHLVKLNU-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 6-hydroxynaphthalene-2-carboxamide |
| InChIKey | AHOQHQUHLVKLNU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C(=O)N |
Computed by PubChem (NCBI)