Products 625446-50-6
CAS 625446-50-6 appears in our catalog under these names: 1-(4-Bromo-2-fluorophenyl)pyrrolidin-2-one, 98%, 1-(4-Bromo-2-fluorophenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(4-bromo-2-fluorophenyl)pyrrolidin-2-one (CAS 625446-50-6) is a chemical compound with the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)pyrrolidin-2-one. InChIKey: CKTMNWZSXNKEPM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)pyrrolidin-2-one |
| InChIKey | CKTMNWZSXNKEPM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)