CAS 6270-14-0 is the registry number for 7-Nitroquinolin-4-ol, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-nitro-1H-quinolin-4-one (CAS 6270-14-0) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 7-nitro-1H-quinolin-4-one. InChIKey: MLPKSYLYDHCVOI-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 7-nitro-1H-quinolin-4-one |
| InChIKey | MLPKSYLYDHCVOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=CC2=O |
Computed by PubChem (NCBI)