CAS 62732-89-2 is the registry number for 5,6-Dimethoxy-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g, 5g.
5,6-dimethoxy-1H-indazol-3-amine (CAS 62732-89-2) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: 5,6-dimethoxy-1H-indazol-3-amine. InChIKey: HWSWPEQLIYUPGC-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 5,6-dimethoxy-1H-indazol-3-amine |
| InChIKey | HWSWPEQLIYUPGC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NN2)N)OC |
Computed by PubChem (NCBI)