Products 62732-91-6

CAS 62732-91-6 is the registry number for Debacarb. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 100mg, 10mg, 0,1g.

Structural formula: {0} (CAS {1})

2-(2-ethoxyethoxy)ethyl N-(1H-benzimidazol-2-yl)carbamate (CAS 62732-91-6) is a chemical compound with the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. IUPAC name: 2-(2-ethoxyethoxy)ethyl N-(1H-benzimidazol-2-yl)carbamate. InChIKey: DNBMPXLFKQCOBV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19N3O4
Molecular weight293.32 g/mol
IUPAC name2-(2-ethoxyethoxy)ethyl N-(1H-benzimidazol-2-yl)carbamate
InChIKeyDNBMPXLFKQCOBV-UHFFFAOYSA-N
SMILESCCOCCOCCOC(=O)NC1=NC2=CC=CC=C2N1

Computed by PubChem (NCBI)