Products 6274-82-4
CAS 6274-82-4 appears in our catalog under these names: 2,6-Dimethoxyisonicotinic acid, 95%, 2，6–Dimethoxyisonicotinic acid, 2,6-Dimethoxyisonicotinic acid, 2,6-Dimethoxyisonicotinic acid 98%, 2,6-Dimethoxyisonicotinic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 500mg, 2.5g.
2,6-dimethoxypyridine-4-carboxylic acid (CAS 6274-82-4) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2,6-dimethoxypyridine-4-carboxylic acid. InChIKey: BLBZPNCBYHYDDP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2,6-dimethoxypyridine-4-carboxylic acid |
| InChIKey | BLBZPNCBYHYDDP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=N1)OC)C(=O)O |
Computed by PubChem (NCBI)