CAS 627839-96-7 appears in our catalog under these names: 5-(Piperidin-1-ylsulfonyl)pyridin-2(1h)-one, 98%, 5-(Piperidine-1-sulfonyl)-1,2-dihydropyridin-2-one. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
5-piperidin-1-ylsulfonyl-1H-pyridin-2-one (CAS 627839-96-7) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 5-piperidin-1-ylsulfonyl-1H-pyridin-2-one. InChIKey: OBVYPGJJMNVGLY-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 5-piperidin-1-ylsulfonyl-1H-pyridin-2-one |
| InChIKey | OBVYPGJJMNVGLY-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)