CAS 62784-62-7 is the registry number for 3-(Benzoyloxy)cyclohexanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 100mg.
(3-oxocyclohexyl) benzoate (CAS 62784-62-7) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: (3-oxocyclohexyl) benzoate. InChIKey: SWVSKVATFCRHJX-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (3-oxocyclohexyl) benzoate |
| InChIKey | SWVSKVATFCRHJX-UHFFFAOYSA-N |
| SMILES | C1CC(CC(=O)C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)