CAS 62826-31-7 is the registry number for 2-{(2-(Trifluoromethyl)phenyl)methyl}oxirane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[[2-(trifluoromethyl)phenyl]methyl]oxirane (CAS 62826-31-7) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 2-[[2-(trifluoromethyl)phenyl]methyl]oxirane. InChIKey: MMFCMICIKUOWGM-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 2-[[2-(trifluoromethyl)phenyl]methyl]oxirane |
| InChIKey | MMFCMICIKUOWGM-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)