CAS 62882-07-9 is the registry number for 2-(2-Nitrophenyl)-1,3-oxazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-nitrophenyl)-1,3-oxazole (CAS 62882-07-9) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 2-(2-nitrophenyl)-1,3-oxazole. InChIKey: JWLIPOOAITVBES-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2-(2-nitrophenyl)-1,3-oxazole |
| InChIKey | JWLIPOOAITVBES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)