CAS 62882-08-0 appears in our catalog under these names: 2-(4-Nitrophenyl)oxazole, 98%, 2-(4-Nitrophenyl)oxazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g, 2,5g.
2-(4-nitrophenyl)-1,3-oxazole (CAS 62882-08-0) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-oxazole. InChIKey: XHBVYYMFLQGIJX-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-oxazole |
| InChIKey | XHBVYYMFLQGIJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)