Products 62903-13-3
CAS 62903-13-3 appears in our catalog under these names: 4–(3–Bromophenyl)–4–oxobutanoic acid, 4-(3-Bromophenyl)-4-oxobutyric acid, 4-(3-Bromophenyl)-4-oxobutanoic acid, 95%, 4-(3-Bromophenyl)-4-oxobutanoic acid, 95%(LC-MS),RG, 95%(LC-MS),RG, 4-(3-Bromophenyl)-4-oxobutyric acid, 95%(LC-MS),RG. Offered by: GLPBio, Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 1g, 250mg.
4-(3-bromophenyl)-4-oxobutanoic acid (CAS 62903-13-3) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 4-(3-bromophenyl)-4-oxobutanoic acid. InChIKey: STMSZUNULHZOJT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 4-(3-bromophenyl)-4-oxobutanoic acid |
| InChIKey | STMSZUNULHZOJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)