Products 629643-26-1
CAS 629643-26-1 is the registry number for Gnetucleistol D. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
5-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]benzene-1,3-diol (CAS 629643-26-1) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 5-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]benzene-1,3-diol. InChIKey: CFQSTARVCGBYNJ-NSCUHMNNSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 5-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]benzene-1,3-diol |
| InChIKey | CFQSTARVCGBYNJ-NSCUHMNNSA-N |
| SMILES | COC1=C(C=CC(=C1)O)/C=C/C2=CC(=CC(=C2)O)O |
Computed by PubChem (NCBI)