CAS 62965-10-0 appears in our catalog under these names: Cbz-L-tert-Leucine, 98%, Cbz-L-tert-Leucine, N–Benzyloxycarbonyl–L–tert–leucine, Cbz-Tle-OH 95%, (S)-2-(((Benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 500g.
(2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 62965-10-0) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: NSVNKQLSGGKNKB-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | NSVNKQLSGGKNKB-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)