CAS 70874-05-4 appears in our catalog under these names: Cbzl-d-tert-leucine, 97%, (R)–2–(((Benzyloxy)carbonyl)amino)–3,3–dimethylbutanoic acid, Cbz-D-Tle-OH 96%, CBZL-D-TERT-LEUCINE, 96%, 96%, (R)-2-(((Benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid, 96.17%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 500mg, 100mg, 5 g, 500 mg, 1 g.
(2R)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 70874-05-4) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: NSVNKQLSGGKNKB-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | NSVNKQLSGGKNKB-NSHDSACASA-N |
| SMILES | CC(C)(C)[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)