CAS 62965-20-2 appears in our catalog under these names: (S)-2-Amino-4-(benzyloxy)butanoic acid, 95%, (S)-2-Amino-4-(benzyloxy)butanoic acid, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2S)-2-amino-4-phenylmethoxybutanoic acid (CAS 62965-20-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S)-2-amino-4-phenylmethoxybutanoic acid. InChIKey: QTPSXPIAJFBGLO-JTQLQIEISA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S)-2-amino-4-phenylmethoxybutanoic acid |
| InChIKey | QTPSXPIAJFBGLO-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)