CAS 630091-50-8 appears in our catalog under these names: 4-(5-Methyl-1h-benzo[d]imidazol-2-yl)butanoic acid, 95%, 4-(5-Methyl-1H-benzo(d)imidazol-2-yl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-(6-methyl-1H-benzimidazol-2-yl)butanoic acid (CAS 630091-50-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 4-(6-methyl-1H-benzimidazol-2-yl)butanoic acid. InChIKey: GUDKLOGDDMOAHG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 4-(6-methyl-1H-benzimidazol-2-yl)butanoic acid |
| InChIKey | GUDKLOGDDMOAHG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)CCCC(=O)O |
Computed by PubChem (NCBI)