Products 630422-37-6
CAS 630422-37-6 is the registry number for 2-CYCLOPROPYL-6,7-DIMETHOXY-4(3H)-QUINAZOLINONE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-cyclopropyl-6,7-dimethoxy-3H-quinazolin-4-one (CAS 630422-37-6) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 2-cyclopropyl-6,7-dimethoxy-3H-quinazolin-4-one. InChIKey: CJZDASFMLDXNCL-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2-cyclopropyl-6,7-dimethoxy-3H-quinazolin-4-one |
| InChIKey | CJZDASFMLDXNCL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NC(=N2)C3CC3)OC |
Computed by PubChem (NCBI)