Products 63089-54-3
CAS 63089-54-3 is the registry number for 1,2,3,5,6,7-Hexahydro-s-indacen-4-ol, ≥95%. Offered by: Chemat. Available pack sizes: 50mg.
1,2,3,5,6,7-hexahydro-s-indacen-4-ol (CAS 63089-54-3) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 1,2,3,5,6,7-hexahydro-s-indacen-4-ol. InChIKey: DKOZCRXBVJZULD-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1,2,3,5,6,7-hexahydro-s-indacen-4-ol |
| InChIKey | DKOZCRXBVJZULD-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(CCC3)C(=C2C1)O |
Computed by PubChem (NCBI)