CAS 63096-02-6 appears in our catalog under these names: Methyl (tert–butoxycarbonyl)–L–leucinate, Boc-Leu-OMe 97%, Boc-Leu-OMe, 97%, 97%, Methyl (tert-butoxycarbonyl)-L-leucinate, 99.11%, Boc-Leu-OMe, 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g, 25 g, 100 g.
Methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 63096-02-6) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: QSEVMIMUBKMNOU-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | QSEVMIMUBKMNOU-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)