CAS 6311-22-4 appears in our catalog under these names: 9-Methyl-9h-fluoren-9-ol, 95%, 9–Methyl–9H–fluoren–9–ol, 9-Methyl-9H-fluoren-9-ol 98%, 9-Methyl-9H-fluoren-9-ol, 98%, 98%, 9-METHYL-9H-FLUOREN-9-OL, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 200mg, 10g.
9-methylfluoren-9-ol (CAS 6311-22-4) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 9-methylfluoren-9-ol. InChIKey: ZMXJQEIJNHMYDY-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 9-methylfluoren-9-ol |
| InChIKey | ZMXJQEIJNHMYDY-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC=CC=C31)O |
Computed by PubChem (NCBI)