CAS 63177-14-0 appears in our catalog under these names: 3-Hydroxy-6,7-dimethoxyisoquinolin-1(2H)-one, 98%, 6,7-DIMETHOXYISOQUINOLINE-1,3(2H,4H)-DIONE, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
6,7-dimethoxy-4H-isoquinoline-1,3-dione (CAS 63177-14-0) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 6,7-dimethoxy-4H-isoquinoline-1,3-dione. InChIKey: JTVAUSVXSGDYTN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 6,7-dimethoxy-4H-isoquinoline-1,3-dione |
| InChIKey | JTVAUSVXSGDYTN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(=O)NC2=O)OC |
Computed by PubChem (NCBI)