CAS 63199-70-2 is the registry number for Buphedrone metabolite (hydrochloride) ((±)–Ephedrine stereochemistry). Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
(1S,2R)-2-(methylamino)-1-phenylbutan-1-ol;hydrochloride (CAS 63199-70-2) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (1S,2R)-2-(methylamino)-1-phenylbutan-1-ol;hydrochloride. InChIKey: DBIYVUUUZVZMQD-DHXVBOOMSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (1S,2R)-2-(methylamino)-1-phenylbutan-1-ol;hydrochloride |
| InChIKey | DBIYVUUUZVZMQD-DHXVBOOMSA-N |
| SMILES | CC[C@H]([C@H](C1=CC=CC=C1)O)NC.Cl |
Computed by PubChem (NCBI)