CAS 6320-50-9 appears in our catalog under these names: 5-(4-Bromophenyl)-5-methylimidazolidine-2,4-dione, 98%, 5-(4-Bromophenyl)-5-methylimidazolidine-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.
5-(4-bromophenyl)-5-methylimidazolidine-2,4-dione (CAS 6320-50-9) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 5-(4-bromophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: ZQUNVNMQLMHUDO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 5-(4-bromophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | ZQUNVNMQLMHUDO-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)