Products 63243-76-5
CAS 63243-76-5 appears in our catalog under these names: ethyl 2-amino-5-bromobenzoate, Ethyl 2-amino-5-bromobenzoate 98%, Ethyl 2-Amino-5-bromobenzoate, 98%, Ethyl 2-amino-5-bromobenzoate, 98%, 98%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100g.
Ethyl 2-amino-5-bromobenzoate (CAS 63243-76-5) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 2-amino-5-bromobenzoate. InChIKey: PKWFESSNWKEZDP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 2-amino-5-bromobenzoate |
| InChIKey | PKWFESSNWKEZDP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)N |
Computed by PubChem (NCBI)