CAS 63319-95-9 is the registry number for Agomelatine Acetic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2E)-2-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid (CAS 63319-95-9) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: (2E)-2-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid. InChIKey: XNPWRVMAMATBMA-JXMROGBWSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2E)-2-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
| InChIKey | XNPWRVMAMATBMA-JXMROGBWSA-N |
| SMILES | COC1=CC\2=C(CCC/C2=C\C(=O)O)C=C1 |
Computed by PubChem (NCBI)