CAS 633296-51-2 is the registry number for Dyphylline Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide (CAS 633296-51-2) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide. InChIKey: FWLHJDYPCCGQIO-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide |
| InChIKey | FWLHJDYPCCGQIO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=O)N(C(=O)N1C)C |
Computed by PubChem (NCBI)