Products 6336-34-1
CAS 6336-34-1 appears in our catalog under these names: OUL35, OUL35/ 99.2% (existing batch purity), OUL 35, OUL35, 99.80%, 4,4'-Oxydibenzamide, 95%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 200mg, 5 mg, 10 mg.
4-(4-carbamoylphenoxy)benzamide (CAS 6336-34-1) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 4-(4-carbamoylphenoxy)benzamide. InChIKey: XZRCQWLPMXFGHE-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 4-(4-carbamoylphenoxy)benzamide |
| InChIKey | XZRCQWLPMXFGHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)OC2=CC=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)