CAS 63399-71-3 appears in our catalog under these names: 1-Cbz-2-methyl-L-proline, 96%, 1-Cbz-2-methyl-L-proline, 98%, 1-Cbz-2-methyl-L-proline, 97%, 97%, (S)-1-((Benzyloxy)carbonyl)-2-methylpyrrolidine-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
(2S)-2-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 63399-71-3) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: (2S)-2-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: RPUQYVRDBWUEOR-AWEZNQCLSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | (2S)-2-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | RPUQYVRDBWUEOR-AWEZNQCLSA-N |
| SMILES | C[C@]1(CCCN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)