CAS 88466-74-4 appears in our catalog under these names: (S)-Piperidine-1,3-dicarboxylic acid 1-benzyl ester, 97%, (S)-1-((Benzyloxy)carbonyl)piperidine-3-carboxylic acid, 97%, 97%, L-1-Cbz-Nipecotic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg.
(3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 88466-74-4) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: (3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: FFLPIVZNYJKKDM-LBPRGKRZSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | (3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | FFLPIVZNYJKKDM-LBPRGKRZSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)