CAS 28697-07-6 appears in our catalog under these names: 1-Cbz-2-piperidinecarboxylic acid, 95%, N–Cbz–2–Piperidinecarboxylic acid, 1-Carbobenzoxy-2-piperidinecarboxylic Acid, >98.0%(GC)(T), N-Cbz-2-Piperidinecarboxylic acid, 98%, 98%, N-Cbz-2-Piperidinecarboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 10g.
1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (CAS 28697-07-6) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 1-phenylmethoxycarbonylpiperidine-2-carboxylic acid. InChIKey: ZSAIHAKADPJIGN-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| InChIKey | ZSAIHAKADPJIGN-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)