CAS 1956434-58-4 is the registry number for (S)-5-(2-Amino-2-phenylethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(2-amino-2-phenylethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 1956434-58-4) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 5-(2-amino-2-phenylethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: HHALSYMJKXLKBU-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 5-(2-amino-2-phenylethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | HHALSYMJKXLKBU-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)CC(C2=CC=CC=C2)N)C |
Computed by PubChem (NCBI)