Products 634-38-8
CAS 634-38-8 appears in our catalog under these names: 2–Methylquinoline–4–carboxylic acid, 2-Methyl-quinoline-4-carboxylic acid, 2-Methylquinoline-4-carboxylic acid 98%, 2-Methylquinoline-4-carboxylic acid, 98%, 98%, 2-Methylquinoline-4-carboxylic acid, 90%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 1g.
2-methylquinoline-4-carboxylic acid (CAS 634-38-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-methylquinoline-4-carboxylic acid. InChIKey: UIDHNPTVQFNWOJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-methylquinoline-4-carboxylic acid |
| InChIKey | UIDHNPTVQFNWOJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)