Products 63407-32-9

CAS 63407-32-9 is the registry number for 2-Amino-4-hydroxy-5-methoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

2-amino-4-hydroxy-5-methoxybenzoic acid (CAS 63407-32-9) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2-amino-4-hydroxy-5-methoxybenzoic acid. InChIKey: IEVFOUHGGVWJJD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4
Molecular weight183.16 g/mol
IUPAC name2-amino-4-hydroxy-5-methoxybenzoic acid
InChIKeyIEVFOUHGGVWJJD-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)O)N)O

Computed by PubChem (NCBI)