CAS 6341-97-5 appears in our catalog under these names: 2,4-Dichlorophenyl acetate, 97%, 97%, 2,4-DICHLOROPHENOL ACETATE, 97%, 2,4-Dichlorophenyl acetate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(2,4-dichlorophenyl) acetate (CAS 6341-97-5) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: (2,4-dichlorophenyl) acetate. InChIKey: KGXUYVOKSRCTEK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | (2,4-dichlorophenyl) acetate |
| InChIKey | KGXUYVOKSRCTEK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)