Products 63449-68-3
CAS 63449-68-3 appears in our catalog under these names: Naphthalen-2-yl 2-aminobenzoate, 2-Hydroxynaphthalen 2-aminobenzoate, ≥95%, 2-Aminobenzoic acid naphthalen-2-yl ester, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 50mg, 1g.
Naphthalen-2-yl 2-aminobenzoate (CAS 63449-68-3) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: naphthalen-2-yl 2-aminobenzoate. InChIKey: YJFCKXVXEKHSEC-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | naphthalen-2-yl 2-aminobenzoate |
| InChIKey | YJFCKXVXEKHSEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OC(=O)C3=CC=CC=C3N |
Computed by PubChem (NCBI)
Synonyms:
naphthalen-2-yl 2-aminobenzoate, beta-Naphthyl anthranilate, 2-Naphthyl anthranilate, 2-Naphthalenol, 2-aminobenzoate, 2-Naphthyl O-aminobenzoate, Anthranilic acid, 2-naphthyl ester, 2-Aminobenzoyl 2-naphthalenol, FEMA No. 2767, 2-Naphthalenol, 2-(2-aminobenzoate), 2-Naphthalenol, 2-aminobenzoyl ester