CAS 63469-11-4 appears in our catalog under these names: 1-Nitro-4-(pentyloxy)benzene, 95%, 95%, P-Nitrophenyl pentyl ether, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-nitro-4-pentoxybenzene (CAS 63469-11-4) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 1-nitro-4-pentoxybenzene. InChIKey: ITRUYYFRYGZFBF-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 1-nitro-4-pentoxybenzene |
| InChIKey | ITRUYYFRYGZFBF-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)