CAS 63475-29-6 appears in our catalog under these names: Methyl 1-ethyl-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate, 95%, Nalidixic Acid Methyl Ester. Offered by: Combi-blocks, Mikromol. Available pack sizes: 1g, 5g, 4x25mg, 25mg.
Methyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (CAS 63475-29-6) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: methyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate. InChIKey: HAXZNPSPJMKMIQ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | methyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| InChIKey | HAXZNPSPJMKMIQ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)OC |
Computed by PubChem (NCBI)