CAS 63543-87-3 appears in our catalog under these names: 2-Methyl-8-quinolinol 1-oxide, 95%, 8-Hydroxy-2-methylquinoline 1-oxide 95%, 8-Hydroxy-2-methylquinoline 1-oxide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-methyl-1-oxidoquinolin-1-ium-8-ol (CAS 63543-87-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-methyl-1-oxidoquinolin-1-ium-8-ol. InChIKey: HFRZWXVRWSIHNU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-methyl-1-oxidoquinolin-1-ium-8-ol |
| InChIKey | HFRZWXVRWSIHNU-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=C(C=CC=C2O)C=C1)[O-] |
Computed by PubChem (NCBI)